C17H20N2O3 — CID 70083468
2-[1-(1,2-oxazol-5-ylmethyl)-2-phenylpiperidin-4-yl]acetic acid (PubChem CID 70083468) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[1-(1,2-oxazol-5-ylmethyl)-2-phenylpiperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(1,2-oxazol-5-ylmethyl)-2-phenylpiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 70083468 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-[1-(1,2-oxazol-5-ylmethyl)-2-phenylpiperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(Cc2ccno2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H20N2O3/c20-17(21)11-13-7-9-19(12-15-6-8-18-22-15)16(10-13)14-4-2-1-3-5-14/h1-6,8,13,16H,7,9-12H2,(H,20,21) |
| InChIKey | WFIMFTCEZOYDMQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |