About 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid
4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid (PubChem CID 70083784) has the molecular formula C25H28O2
and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid |
| PubChem CID | 70083784 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid |
| SMILES | Cc1cc2c(cc1C=Cc1ccc(C(=O)O)cc1)C(C(C)C)=CCC2(C)C |
| InChI | InChI=1S/C25H28O2/c1-16(2)21-12-13-25(4,5)23-14-17(3)20(15-22(21)23)11-8-18-6-9-19(10-7-18)24(26)27/h6-12,14-16H,13H2,1-5H3,(H,26,27) |
| InChIKey | ORTTVWKRNKUOJE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid?
The IUPAC name of 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid (CID 70083784) is 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid.
What is the SMILES notation for 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid?
The canonical SMILES for 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid is Cc1cc2c(cc1C=Cc1ccc(C(=O)O)cc1)C(C(C)C)=CCC2(C)C.
What is the InChIKey of 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid?
The InChIKey is ORTTVWKRNKUOJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28O2/c1-16(2)21-12-13-25(4,5)23-14-17(3)20(15-22(21)23)11-8-18-6-9-19(10-7-18)24(26)27/h6-12,14-16H,13H2,1-5H3,(H,26,27).
What are the key properties of 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid?
4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid has a molecular weight of 360.50 g/mol, XLogP of 6.58, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,5,5-trimethyl-8-propan-2-yl-6H-naphthalen-2-yl)ethenyl]benzoic acid is sourced from PubChem (CID 70083784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).