C26H36N4O2S — CID 70083879
5-[[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]methyl]thiophene-2-carboximidamide (PubChem CID 70083879) has the molecular formula C26H36N4O2S and a molecular weight of 468.67 g/mol. Its IUPAC name is 5-[[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]methyl]thiophene-2-carboximidamide.
| Compound Name | 5-[[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]methyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 70083879 |
| Molecular Formula | C26H36N4O2S |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 5-[[4-[5-[(2R,6S)-2,6-dimethylpiperidin-2-yl]pentyl]-3-oxo-1,4-benzoxazin-2-yl]methyl]thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CC2Oc3ccccc3N(CCCCC[C@]3(C)CCC[C@H](C)N3)C2=O)s1 |
| InChI | InChI=1S/C26H36N4O2S/c1-18-9-8-15-26(2,29-18)14-6-3-7-16-30-20-10-4-5-11-21(20)32-22(25(30)31)17-19-12-13-23(33-19)24(27)28/h4-5,10-13,18,22,29H,3,6-9,14-17H2,1-2H3,(H3,27,28)/t18-,22?,26+/m0/s1 |
| InChIKey | INZQMPKIIITXTA-ILWLLMGSSA-N |
| XLogP | 4.85 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|