C11H17N3O2S2 — CID 7008410
5-(2-tert-butylsulfanylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7008410) has the molecular formula C11H17N3O2S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 5-(2-tert-butylsulfanylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(2-tert-butylsulfanylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7008410 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 5-(2-tert-butylsulfanylethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CC(C)(C)SCC/N=C/C1C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C11H17N3O2S2/c1-11(2,3)18-5-4-12-6-7-8(15)13-10(17)14-9(7)16/h6-7H,4-5H2,1-3H3,(H2,13,14,15,16,17)/b12-6+ |
| InChIKey | CXVVFJOTUYXNIK-WUXMJOGZSA-N |
| XLogP | 0.74 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|