About [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride
[1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 70084109) has the molecular formula C17H19ClF2N2
and a molecular weight of 324.80 g/mol. Its IUPAC name is [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride |
| PubChem CID | 70084109 |
| Molecular Formula | C17H19ClF2N2 |
| Molecular Weight | 324.80 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCN(c2ccc(F)cc2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18F2N2.ClH/c18-14-3-1-12(2-4-14)17-13(11-20)9-10-21(17)16-7-5-15(19)6-8-16;/h1-8,13,17H,9-11,20H2;1H |
| InChIKey | CXRLLQWRBNDKPD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride?
The IUPAC name of [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride (CID 70084109) is [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride.
What is the SMILES notation for [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride?
The canonical SMILES for [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride is Cl.NCC1CCN(c2ccc(F)cc2)C1c1ccc(F)cc1.
What is the InChIKey of [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride?
The InChIKey is CXRLLQWRBNDKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2N2.ClH/c18-14-3-1-12(2-4-14)17-13(11-20)9-10-21(17)16-7-5-15(19)6-8-16;/h1-8,13,17H,9-11,20H2;1H.
What are the key properties of [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride?
[1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride has a molecular weight of 324.80 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-bis(4-fluorophenyl)pyrrolidin-3-yl]methanamine;hydrochloride is sourced from PubChem (CID 70084109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).