About methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate
methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 70084866) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 70084866 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=C(OC)C(=C2CCCC2)C1C |
| InChI | InChI=1S/C15H20O3/c1-10-12(15(16)18-3)8-9-13(17-2)14(10)11-6-4-5-7-11/h8-10H,4-7H2,1-3H3 |
| InChIKey | WPVXSBPNMJACCU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate (CID 70084866) is methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate is COC(=O)C1=CC=C(OC)C(=C2CCCC2)C1C.
What is the InChIKey of methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is WPVXSBPNMJACCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-10-12(15(16)18-3)8-9-13(17-2)14(10)11-6-4-5-7-11/h8-10H,4-7H2,1-3H3.
What are the key properties of methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate?
methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 248.32 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-cyclopentylidene-4-methoxy-6-methylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 70084866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).