About 1,2-dimethoxy-3,4-dihydro-2H-pyridine
1,2-dimethoxy-3,4-dihydro-2H-pyridine (PubChem CID 70085192) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 1,2-dimethoxy-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1,2-dimethoxy-3,4-dihydro-2H-pyridine |
| PubChem CID | 70085192 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 1,2-dimethoxy-3,4-dihydro-2H-pyridine |
| SMILES | COC1CCC=CN1OC |
| InChI | InChI=1S/C7H13NO2/c1-9-7-5-3-4-6-8(7)10-2/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | ANPSZRROGPDCBS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dimethoxy-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethoxy-3,4-dihydro-2H-pyridine?
The IUPAC name of 1,2-dimethoxy-3,4-dihydro-2H-pyridine (CID 70085192) is 1,2-dimethoxy-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 1,2-dimethoxy-3,4-dihydro-2H-pyridine?
The canonical SMILES for 1,2-dimethoxy-3,4-dihydro-2H-pyridine is COC1CCC=CN1OC.
What is the InChIKey of 1,2-dimethoxy-3,4-dihydro-2H-pyridine?
The InChIKey is ANPSZRROGPDCBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-9-7-5-3-4-6-8(7)10-2/h4,6-7H,3,5H2,1-2H3.
What are the key properties of 1,2-dimethoxy-3,4-dihydro-2H-pyridine?
1,2-dimethoxy-3,4-dihydro-2H-pyridine has a molecular weight of 143.19 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxy-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 70085192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).