C27H31NO3 — CID 70086289
(2R)-2-[2-(9-methyl-5,6,7,8-tetrahydrocarbazol-2-yl)-2-oxoethyl]-6-phenylhexanoic acid (PubChem CID 70086289) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is (2R)-2-[2-(9-methyl-5,6,7,8-tetrahydrocarbazol-2-yl)-2-oxoethyl]-6-phenylhexanoic acid.
| Compound Name | (2R)-2-[2-(9-methyl-5,6,7,8-tetrahydrocarbazol-2-yl)-2-oxoethyl]-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 70086289 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (2R)-2-[2-(9-methyl-5,6,7,8-tetrahydrocarbazol-2-yl)-2-oxoethyl]-6-phenylhexanoic acid |
| SMILES | Cn1c2c(c3ccc(C(=O)C[C@@H](CCCCc4ccccc4)C(=O)O)cc31)CCCC2 |
| InChI | InChI=1S/C27H31NO3/c1-28-24-14-8-7-13-22(24)23-16-15-20(17-25(23)28)26(29)18-21(27(30)31)12-6-5-11-19-9-3-2-4-10-19/h2-4,9-10,15-17,21H,5-8,11-14,18H2,1H3,(H,30,31)/t21-/m1/s1 |
| InChIKey | VNPFQMGNNQYTHB-OAQYLSRUSA-N |
| XLogP | 5.74 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|