About 1H-azepine-3-carboxylic acid;methanamine;piperazine
1H-azepine-3-carboxylic acid;methanamine;piperazine (PubChem CID 70086311) has the molecular formula C12H22N4O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 1H-azepine-3-carboxylic acid;methanamine;piperazine.
Molecular Properties
| Compound Name | 1H-azepine-3-carboxylic acid;methanamine;piperazine |
| PubChem CID | 70086311 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1H-azepine-3-carboxylic acid;methanamine;piperazine |
| SMILES | C1CNCCN1.CN.O=C(O)C1=CNC=CC=C1 |
| InChI | InChI=1S/C7H7NO2.C4H10N2.CH5N/c9-7(10)6-3-1-2-4-8-5-6;1-2-6-4-3-5-1;1-2/h1-5,8H,(H,9,10);5-6H,1-4H2;2H2,1H3 |
| InChIKey | NMWYKVKFSMNIAC-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1H-azepine-3-carboxylic acid;methanamine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine-3-carboxylic acid;methanamine;piperazine?
The IUPAC name of 1H-azepine-3-carboxylic acid;methanamine;piperazine (CID 70086311) is 1H-azepine-3-carboxylic acid;methanamine;piperazine.
What is the SMILES notation for 1H-azepine-3-carboxylic acid;methanamine;piperazine?
The canonical SMILES for 1H-azepine-3-carboxylic acid;methanamine;piperazine is C1CNCCN1.CN.O=C(O)C1=CNC=CC=C1.
What is the InChIKey of 1H-azepine-3-carboxylic acid;methanamine;piperazine?
The InChIKey is NMWYKVKFSMNIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C4H10N2.CH5N/c9-7(10)6-3-1-2-4-8-5-6;1-2-6-4-3-5-1;1-2/h1-5,8H,(H,9,10);5-6H,1-4H2;2H2,1H3.
What are the key properties of 1H-azepine-3-carboxylic acid;methanamine;piperazine?
1H-azepine-3-carboxylic acid;methanamine;piperazine has a molecular weight of 254.33 g/mol, XLogP of -0.62, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine-3-carboxylic acid;methanamine;piperazine is sourced from PubChem (CID 70086311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).