C21H40N2O2 — CID 70088087
(E,4S,6S,7S)-7-amino-N-butyl-8-cyclohexyl-6-hydroxy-4-propan-2-yloct-2-enamide (PubChem CID 70088087) has the molecular formula C21H40N2O2 and a molecular weight of 352.56 g/mol. Its IUPAC name is (E,4S,6S,7S)-7-amino-N-butyl-8-cyclohexyl-6-hydroxy-4-propan-2-yloct-2-enamide.
| Compound Name | (E,4S,6S,7S)-7-amino-N-butyl-8-cyclohexyl-6-hydroxy-4-propan-2-yloct-2-enamide |
|---|---|
| PubChem CID | 70088087 |
| Molecular Formula | C21H40N2O2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | (E,4S,6S,7S)-7-amino-N-butyl-8-cyclohexyl-6-hydroxy-4-propan-2-yloct-2-enamide |
| SMILES | CCCCNC(=O)/C=C/[C@@H](C[C@H](O)[C@@H](N)CC1CCCCC1)C(C)C |
| InChI | InChI=1S/C21H40N2O2/c1-4-5-13-23-21(25)12-11-18(16(2)3)15-20(24)19(22)14-17-9-7-6-8-10-17/h11-12,16-20,24H,4-10,13-15,22H2,1-3H3,(H,23,25)/b12-11+/t18-,19-,20-/m0/s1 |
| InChIKey | IBOFIYQVRKEMCM-XKYQUPDSSA-N |
| XLogP | 3.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|