About 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide
3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide (PubChem CID 70088143) has the molecular formula C19H19Cl2FN2O2
and a molecular weight of 397.28 g/mol. Its IUPAC name is 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide.
Molecular Properties
| Compound Name | 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide |
| PubChem CID | 70088143 |
| Molecular Formula | C19H19Cl2FN2O2 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c(CF)c1C1CCCC1 |
| InChI | InChI=1S/C19H19Cl2FN2O2/c1-26-16-7-6-12(13(8-22)17(16)11-4-2-3-5-11)19(25)24-18-14(20)9-23-10-15(18)21/h6-7,9-11H,2-5,8H2,1H3,(H,23,24,25) |
| InChIKey | UXMJMIYEKAUWIM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide?
The IUPAC name of 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide (CID 70088143) is 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide.
What is the SMILES notation for 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide?
The canonical SMILES for 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide is COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)c(CF)c1C1CCCC1.
What is the InChIKey of 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide?
The InChIKey is UXMJMIYEKAUWIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2FN2O2/c1-26-16-7-6-12(13(8-22)17(16)11-4-2-3-5-11)19(25)24-18-14(20)9-23-10-15(18)21/h6-7,9-11H,2-5,8H2,1H3,(H,23,24,25).
What are the key properties of 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide?
3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide has a molecular weight of 397.28 g/mol, XLogP of 5.78, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-N-(3,5-dichloro-4-pyridinyl)-2-(fluoromethyl)-4-methoxybenzamide is sourced from PubChem (CID 70088143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).