C27H34FN3O3 — CID 70088161
3-amino-5-(4-fluorophenyl)-3-[(2R,3S)-3-hydroxy-2-(2-methylpropyl)heptanoyl]-1-methyl-1,4-benzodiazepin-2-one (PubChem CID 70088161) has the molecular formula C27H34FN3O3 and a molecular weight of 467.59 g/mol. Its IUPAC name is 3-amino-5-(4-fluorophenyl)-3-[(2R,3S)-3-hydroxy-2-(2-methylpropyl)heptanoyl]-1-methyl-1,4-benzodiazepin-2-one.
| Compound Name | 3-amino-5-(4-fluorophenyl)-3-[(2R,3S)-3-hydroxy-2-(2-methylpropyl)heptanoyl]-1-methyl-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 70088161 |
| Molecular Formula | C27H34FN3O3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 3-amino-5-(4-fluorophenyl)-3-[(2R,3S)-3-hydroxy-2-(2-methylpropyl)heptanoyl]-1-methyl-1,4-benzodiazepin-2-one |
| SMILES | CCCC[C@H](O)[C@@H](CC(C)C)C(=O)C1(N)N=C(c2ccc(F)cc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C27H34FN3O3/c1-5-6-11-23(32)21(16-17(2)3)25(33)27(29)26(34)31(4)22-10-8-7-9-20(22)24(30-27)18-12-14-19(28)15-13-18/h7-10,12-15,17,21,23,32H,5-6,11,16,29H2,1-4H3/t21-,23+,27?/m1/s1 |
| InChIKey | UPVODKQKDYXRMA-VZLBMEDKSA-N |
| XLogP | 4.08 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|