C32H36F3N5O7S — CID 70088350
acetic acid;[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-methylsulfonylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 70088350) has the molecular formula C32H36F3N5O7S and a molecular weight of 691.73 g/mol. Its IUPAC name is acetic acid;[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-methylsulfonylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | acetic acid;[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-methylsulfonylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70088350 |
| Molecular Formula | C32H36F3N5O7S |
| Molecular Weight | 691.73 g/mol |
| Exact Mass | 691.23 |
| IUPAC Name | acetic acid;[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-methylsulfonylindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | CC(=O)O.O=C([O-])C(F)(F)F.[H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc([N+](C)(C)C)cc3)cc3cc(S(C)(=O)=O)ccc32)c1 |
| InChI | InChI=1S/C28H31N5O3S.C2HF3O2.C2H4O2/c1-33(2,3)23-10-8-19(9-11-23)17-31-28(34)26-16-22-15-24(37(4,35)36)12-13-25(22)32(26)18-20-6-5-7-21(14-20)27(29)30;3-2(4,5)1(6)7;1-2(3)4/h5-16H,17-18H2,1-4H3,(H3-,29,30,31,34);(H,6,7);1H3,(H,3,4) |
| InChIKey | SCMFTVKFTXRAEK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 195.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|