About [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide
[4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 70088377) has the molecular formula C26H28N4O4
and a molecular weight of 460.53 g/mol. Its IUPAC name is [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide.
Molecular Properties
| Compound Name | [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide |
| PubChem CID | 70088377 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)CCC2.NCC(=O)Oc1ccc(N)cc1C(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C16H17N3O3.C10H11NO/c17-8-10-2-1-3-11(6-10)16(21)13-7-12(19)4-5-14(13)22-15(20)9-18;11-10(12)9-5-4-7-2-1-3-8(7)6-9/h1-7H,8-9,17-19H2;4-6H,1-3H2,(H2,11,12) |
| InChIKey | YMRBFEJLZFNSDY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 164.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide?
The IUPAC name of [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide (CID 70088377) is [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide.
What is the SMILES notation for [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide?
The canonical SMILES for [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide is NC(=O)c1ccc2c(c1)CCC2.NCC(=O)Oc1ccc(N)cc1C(=O)c1cccc(CN)c1.
What is the InChIKey of [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide?
The InChIKey is YMRBFEJLZFNSDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3.C10H11NO/c17-8-10-2-1-3-11(6-10)16(21)13-7-12(19)4-5-14(13)22-15(20)9-18;11-10(12)9-5-4-7-2-1-3-8(7)6-9/h1-7H,8-9,17-19H2;4-6H,1-3H2,(H2,11,12).
What are the key properties of [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide?
[4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide has a molecular weight of 460.53 g/mol, XLogP of 2.10, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-2-[3-(aminomethyl)benzoyl]phenyl] 2-aminoacetate;2,3-dihydro-1H-indene-5-carboxamide is sourced from PubChem (CID 70088377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).