C9H8N2O3 — CID 700885
1-(4-hydroxyphenyl)imidazolidine-2,4-dione (PubChem CID 700885) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 1-(4-hydroxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 700885 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 1-(4-hydroxyphenyl)imidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccc(O)cc2)C(=O)N1 |
| InChI | InChI=1S/C9H8N2O3/c12-7-3-1-6(2-4-7)11-5-8(13)10-9(11)14/h1-4,12H,5H2,(H,10,13,14) |
| InChIKey | AJSRHILLPJYTMO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|