About 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole
2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole (PubChem CID 70088513) has the molecular formula C9H6N2S2
and a molecular weight of 206.30 g/mol. Its IUPAC name is 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole |
| PubChem CID | 70088513 |
| Molecular Formula | C9H6N2S2 |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole |
| SMILES | Cc1nc(C#Cc2cscn2)cs1 |
| InChI | InChI=1S/C9H6N2S2/c1-7-11-9(5-13-7)3-2-8-4-12-6-10-8/h4-6H,1H3 |
| InChIKey | OLGDUNSXOGTHQZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole?
The IUPAC name of 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole (CID 70088513) is 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole.
What is the SMILES notation for 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole?
The canonical SMILES for 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole is Cc1nc(C#Cc2cscn2)cs1.
What is the InChIKey of 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole?
The InChIKey is OLGDUNSXOGTHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2S2/c1-7-11-9(5-13-7)3-2-8-4-12-6-10-8/h4-6H,1H3.
What are the key properties of 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole?
2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole has a molecular weight of 206.30 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[2-(1,3-thiazol-4-yl)ethynyl]-1,3-thiazole is sourced from PubChem (CID 70088513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).