C6H4F2N2O2 — CID 70089707
3,5-difluoro-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 70089707) has the molecular formula C6H4F2N2O2 and a molecular weight of 174.11 g/mol. Its IUPAC name is 3,5-difluoro-2-oxo-1H-pyridine-4-carboxamide.
| Compound Name | 3,5-difluoro-2-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 70089707 |
| Molecular Formula | C6H4F2N2O2 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 3,5-difluoro-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | NC(=O)c1c(F)c[nH]c(=O)c1F |
| InChI | InChI=1S/C6H4F2N2O2/c7-2-1-10-6(12)4(8)3(2)5(9)11/h1H,(H2,9,11)(H,10,12) |
| InChIKey | CVXWPYRMVMXSRW-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |