About 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid
4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid (PubChem CID 70089768) has the molecular formula C9H10N6O3
and a molecular weight of 250.22 g/mol. Its IUPAC name is 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 70089768 |
| Molecular Formula | C9H10N6O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid |
| SMILES | NNNNc1c(C(=O)O)noc1-c1cccnc1 |
| InChI | InChI=1S/C9H10N6O3/c10-14-15-12-6-7(9(16)17)13-18-8(6)5-2-1-3-11-4-5/h1-4,12,14-15H,10H2,(H,16,17) |
| InChIKey | ASCCRWNZOLDCTI-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 138.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid (CID 70089768) is 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid is NNNNc1c(C(=O)O)noc1-c1cccnc1.
What is the InChIKey of 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid?
The InChIKey is ASCCRWNZOLDCTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N6O3/c10-14-15-12-6-7(9(16)17)13-18-8(6)5-2-1-3-11-4-5/h1-4,12,14-15H,10H2,(H,16,17).
What are the key properties of 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid?
4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid has a molecular weight of 250.22 g/mol, XLogP of -0.27, 5 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydrazinylhydrazinyl)-5-pyridin-3-yl-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 70089768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).