About 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide
2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide (PubChem CID 70090084) has the molecular formula C14H31N5O3
and a molecular weight of 317.43 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide |
| PubChem CID | 70090084 |
| Molecular Formula | C14H31N5O3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide |
| SMILES | CC[C@H]1CN(C(N)=O)CCN1C.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C8H17N3O.C6H14N2O2/c1-3-7-6-11(8(9)12)5-4-10(7)2;7-4-2-1-3-5(8)6(9)10/h7H,3-6H2,1-2H3,(H2,9,12);5H,1-4,7-8H2,(H,9,10)/t7-;/m0./s1 |
| InChIKey | XAVCPQFVWGZXIZ-FJXQXJEOSA-N |
| XLogP | -0.38 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide?
The IUPAC name of 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide (CID 70090084) is 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide.
What is the SMILES notation for 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide?
The canonical SMILES for 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide is CC[C@H]1CN(C(N)=O)CCN1C.NCCCCC(N)C(=O)O.
What is the InChIKey of 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide?
The InChIKey is XAVCPQFVWGZXIZ-FJXQXJEOSA-N. The full InChI is InChI=1S/C8H17N3O.C6H14N2O2/c1-3-7-6-11(8(9)12)5-4-10(7)2;7-4-2-1-3-5(8)6(9)10/h7H,3-6H2,1-2H3,(H2,9,12);5H,1-4,7-8H2,(H,9,10)/t7-;/m0./s1.
What are the key properties of 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide?
2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide has a molecular weight of 317.43 g/mol, XLogP of -0.38, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diaminohexanoic acid;(3S)-3-ethyl-4-methylpiperazine-1-carboxamide is sourced from PubChem (CID 70090084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).