About 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid
4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid (PubChem CID 70090381) has the molecular formula C18H21N3O4S
and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid |
| PubChem CID | 70090381 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid |
| SMILES | CCOC(=O)N(c1nc(-c2ccc(C(=O)O)cc2)cs1)C1CCNCC1 |
| InChI | InChI=1S/C18H21N3O4S/c1-2-25-18(24)21(14-7-9-19-10-8-14)17-20-15(11-26-17)12-3-5-13(6-4-12)16(22)23/h3-6,11,14,19H,2,7-10H2,1H3,(H,22,23) |
| InChIKey | QHBTUJULFVFQRS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid?
The IUPAC name of 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid (CID 70090381) is 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid.
What is the SMILES notation for 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid?
The canonical SMILES for 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid is CCOC(=O)N(c1nc(-c2ccc(C(=O)O)cc2)cs1)C1CCNCC1.
What is the InChIKey of 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid?
The InChIKey is QHBTUJULFVFQRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O4S/c1-2-25-18(24)21(14-7-9-19-10-8-14)17-20-15(11-26-17)12-3-5-13(6-4-12)16(22)23/h3-6,11,14,19H,2,7-10H2,1H3,(H,22,23).
What are the key properties of 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid?
4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid has a molecular weight of 375.45 g/mol, XLogP of 3.22, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[ethoxycarbonyl(piperidin-4-yl)amino]-1,3-thiazol-4-yl]benzoic acid is sourced from PubChem (CID 70090381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).