About (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene
(6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene (PubChem CID 7009067) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene.
Molecular Properties
| Compound Name | (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene |
| PubChem CID | 7009067 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene |
| SMILES | COC(C[C@H](C)CCC=C(C)C)OC |
| InChI | InChI=1S/C12H24O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h7,11-12H,6,8-9H2,1-5H3/t11-/m1/s1 |
| InChIKey | SEXUFKWNUNQRSS-LLVKDONJSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene?
The IUPAC name of (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene (CID 7009067) is (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene.
What is the SMILES notation for (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene?
The canonical SMILES for (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene is COC(C[C@H](C)CCC=C(C)C)OC.
What is the InChIKey of (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene?
The InChIKey is SEXUFKWNUNQRSS-LLVKDONJSA-N. The full InChI is InChI=1S/C12H24O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h7,11-12H,6,8-9H2,1-5H3/t11-/m1/s1.
What are the key properties of (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene?
(6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene has a molecular weight of 200.32 g/mol, XLogP of 3.38, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-8,8-dimethoxy-2,6-dimethyloct-2-ene is sourced from PubChem (CID 7009067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).