C19H30N3O5PS — CID 70090703
2-[5-[[6-aminohexyl(hydroxy)phosphoryl]amino]-4-oxo-2-phenyl-1,3-thiazepan-3-yl]acetic acid (PubChem CID 70090703) has the molecular formula C19H30N3O5PS and a molecular weight of 443.51 g/mol. Its IUPAC name is 2-[5-[[6-aminohexyl(hydroxy)phosphoryl]amino]-4-oxo-2-phenyl-1,3-thiazepan-3-yl]acetic acid.
| Compound Name | 2-[5-[[6-aminohexyl(hydroxy)phosphoryl]amino]-4-oxo-2-phenyl-1,3-thiazepan-3-yl]acetic acid |
|---|---|
| PubChem CID | 70090703 |
| Molecular Formula | C19H30N3O5PS |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-[5-[[6-aminohexyl(hydroxy)phosphoryl]amino]-4-oxo-2-phenyl-1,3-thiazepan-3-yl]acetic acid |
| SMILES | NCCCCCCP(=O)(O)NC1CCSC(c2ccccc2)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C19H30N3O5PS/c20-11-6-1-2-7-12-28(26,27)21-16-10-13-29-19(15-8-4-3-5-9-15)22(18(16)25)14-17(23)24/h3-5,8-9,16,19H,1-2,6-7,10-14,20H2,(H,23,24)(H2,21,26,27) |
| InChIKey | RLEZDEUOQLKTKL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|