C9H12N2O — CID 70090963
2,3,3a,4-tetrahydro-1H-indole-7-carboxamide (PubChem CID 70090963) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-indole-7-carboxamide.
| Compound Name | 2,3,3a,4-tetrahydro-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 70090963 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-indole-7-carboxamide |
| SMILES | NC(=O)C1=C2NCCC2CC=C1 |
| InChI | InChI=1S/C9H12N2O/c10-9(12)7-3-1-2-6-4-5-11-8(6)7/h1,3,6,11H,2,4-5H2,(H2,10,12) |
| InChIKey | YTRZTHSLMJDTMO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |