About (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine
(S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine (PubChem CID 7009147) has the molecular formula C10H11F2N
and a molecular weight of 183.20 g/mol. Its IUPAC name is 2,2-difluoro-N-[(1S)-1-phenylethyl]ethanimine.
Molecular Properties
| Compound Name | (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine |
| PubChem CID | 7009147 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2,2-difluoro-N-[(1S)-1-phenylethyl]ethanimine |
| SMILES | C[C@@H](C1=CC=CC=C1)N=CC(F)F |
| InChI | InChI=1S/C10H11F2N/c1-8(13-7-10(11)12)9-5-3-2-4-6-9/h2-8,10H,1H3/t8-/m0/s1 |
| InChIKey | MOMZKLAUXURNPG-QMMMGPOBSA-N |
| XLogP | 2.80 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 162 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine?
The IUPAC name of (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine (CID 7009147) is 2,2-difluoro-N-[(1S)-1-phenylethyl]ethanimine.
What is the SMILES notation for (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine?
The canonical SMILES for (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine is C[C@@H](C1=CC=CC=C1)N=CC(F)F.
What is the InChIKey of (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine?
The InChIKey is MOMZKLAUXURNPG-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H11F2N/c1-8(13-7-10(11)12)9-5-3-2-4-6-9/h2-8,10H,1H3/t8-/m0/s1.
What are the key properties of (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine?
(S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine has a molecular weight of 183.20 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-N-(2,2-Difluoroethylidene)-1-phenylethylamine is sourced from PubChem (CID 7009147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).