C22H27F3N2O11S2 — CID 70091600
N-(2-hydroxy-2-methoxyethyl)-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide;sulfuric acid (PubChem CID 70091600) has the molecular formula C22H27F3N2O11S2 and a molecular weight of 616.59 g/mol. Its IUPAC name is N-(2-hydroxy-2-methoxyethyl)-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide;sulfuric acid.
| Compound Name | N-(2-hydroxy-2-methoxyethyl)-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 70091600 |
| Molecular Formula | C22H27F3N2O11S2 |
| Molecular Weight | 616.59 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | N-(2-hydroxy-2-methoxyethyl)-4-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfonylpiperidine-4-carboxamide;sulfuric acid |
| SMILES | COC(O)CNC(=O)C1(S(=O)(=O)c2ccc(Oc3ccc(OC(F)(F)F)cc3)cc2)CCNCC1.O=S(=O)(O)O |
| InChI | InChI=1S/C22H25F3N2O7S.H2O4S/c1-32-19(28)14-27-20(29)21(10-12-26-13-11-21)35(30,31)18-8-6-16(7-9-18)33-15-2-4-17(5-3-15)34-22(23,24)25;1-5(2,3)4/h2-9,19,26,28H,10-14H2,1H3,(H,27,29);(H2,1,2,3,4) |
| InChIKey | MPCGCJUEQQZUBL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 197.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.59 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|