C12H23F2NO2 — CID 70091746
(2R,4R,5S)-5-amino-6-cyclohexyl-3,3-difluorohexane-2,4-diol (PubChem CID 70091746) has the molecular formula C12H23F2NO2 and a molecular weight of 251.32 g/mol. Its IUPAC name is (2R,4R,5S)-5-amino-6-cyclohexyl-3,3-difluorohexane-2,4-diol.
| Compound Name | (2R,4R,5S)-5-amino-6-cyclohexyl-3,3-difluorohexane-2,4-diol |
|---|---|
| PubChem CID | 70091746 |
| Molecular Formula | C12H23F2NO2 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (2R,4R,5S)-5-amino-6-cyclohexyl-3,3-difluorohexane-2,4-diol |
| SMILES | C[C@@H](O)C(F)(F)[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C12H23F2NO2/c1-8(16)12(13,14)11(17)10(15)7-9-5-3-2-4-6-9/h8-11,16-17H,2-7,15H2,1H3/t8-,10+,11-/m1/s1 |
| InChIKey | XTAIHURXULJVKA-DVVUODLYSA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |