C9H13ClN2O — CID 70091908
2,3,3a,4-tetrahydro-1H-indole-7-carboxamide;hydrochloride (PubChem CID 70091908) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-indole-7-carboxamide;hydrochloride.
| Compound Name | 2,3,3a,4-tetrahydro-1H-indole-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70091908 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-indole-7-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1=C2NCCC2CC=C1 |
| InChI | InChI=1S/C9H12N2O.ClH/c10-9(12)7-3-1-2-6-4-5-11-8(6)7;/h1,3,6,11H,2,4-5H2,(H2,10,12);1H |
| InChIKey | AZKOPQDOPCNXCK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |