About N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate
N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate (PubChem CID 70092034) has the molecular formula C23H32N2O6S
and a molecular weight of 464.58 g/mol. Its IUPAC name is N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate.
Molecular Properties
| Compound Name | N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate |
| PubChem CID | 70092034 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate |
| SMILES | CCCC(Sc1ccc(NC(C)=O)cc1)N(C)CCc1ccccc1.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H28N2OS.C2H2O4.H2O/c1-4-8-21(23(3)16-15-18-9-6-5-7-10-18)25-20-13-11-19(12-14-20)22-17(2)24;3-1(4)2(5)6;/h5-7,9-14,21H,4,8,15-16H2,1-3H3,(H,22,24);(H,3,4)(H,5,6);1H2 |
| InChIKey | FWAXSAPXQSZQAX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate?
The IUPAC name of N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate (CID 70092034) is N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate.
What is the SMILES notation for N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate?
The canonical SMILES for N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate is CCCC(Sc1ccc(NC(C)=O)cc1)N(C)CCc1ccccc1.O.O=C(O)C(=O)O.
What is the InChIKey of N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate?
The InChIKey is FWAXSAPXQSZQAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2OS.C2H2O4.H2O/c1-4-8-21(23(3)16-15-18-9-6-5-7-10-18)25-20-13-11-19(12-14-20)22-17(2)24;3-1(4)2(5)6;/h5-7,9-14,21H,4,8,15-16H2,1-3H3,(H,22,24);(H,3,4)(H,5,6);1H2.
What are the key properties of N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate?
N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate has a molecular weight of 464.58 g/mol, XLogP of 3.37, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[1-[methyl(2-phenylethyl)amino]butylsulfanyl]phenyl]acetamide;oxalic acid;hydrate is sourced from PubChem (CID 70092034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).