C15H11ClNO3- — CID 7009272
2-[2-[(3-chlorophenyl)carbamoyl]phenyl]acetate (PubChem CID 7009272) has the molecular formula C15H11ClNO3- and a molecular weight of 288.71 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)carbamoyl]phenyl]acetate.
| Compound Name | 2-[2-[(3-chlorophenyl)carbamoyl]phenyl]acetate |
|---|---|
| PubChem CID | 7009272 |
| Molecular Formula | C15H11ClNO3- |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)carbamoyl]phenyl]acetate |
| SMILES | O=C([O-])Cc1ccccc1C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClNO3/c16-11-5-3-6-12(9-11)17-15(20)13-7-2-1-4-10(13)8-14(18)19/h1-7,9H,8H2,(H,17,20)(H,18,19)/p-1 |
| InChIKey | RBOJNYKJGWNZMI-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |