C27H27N3 — CID 70092832
1-methyl-2-[2-[(2S)-1-(naphthalen-2-ylmethyl)pyrrolidin-2-yl]ethyl]indole-6-carbonitrile (PubChem CID 70092832) has the molecular formula C27H27N3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-methyl-2-[2-[(2S)-1-(naphthalen-2-ylmethyl)pyrrolidin-2-yl]ethyl]indole-6-carbonitrile.
| Compound Name | 1-methyl-2-[2-[(2S)-1-(naphthalen-2-ylmethyl)pyrrolidin-2-yl]ethyl]indole-6-carbonitrile |
|---|---|
| PubChem CID | 70092832 |
| Molecular Formula | C27H27N3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-methyl-2-[2-[(2S)-1-(naphthalen-2-ylmethyl)pyrrolidin-2-yl]ethyl]indole-6-carbonitrile |
| SMILES | Cn1c(CC[C@@H]2CCCN2Cc2ccc3ccccc3c2)cc2ccc(C#N)cc21 |
| InChI | InChI=1S/C27H27N3/c1-29-26(17-24-11-8-20(18-28)16-27(24)29)13-12-25-7-4-14-30(25)19-21-9-10-22-5-2-3-6-23(22)15-21/h2-3,5-6,8-11,15-17,25H,4,7,12-14,19H2,1H3/t25-/m0/s1 |
| InChIKey | OHJKXWAHIFKLRE-VWLOTQADSA-N |
| XLogP | 5.80 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |