About 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid
3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid (PubChem CID 70092858) has the molecular formula C20H26N4O7S
and a molecular weight of 466.52 g/mol. Its IUPAC name is 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid.
Molecular Properties
| Compound Name | 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid |
| PubChem CID | 70092858 |
| Molecular Formula | C20H26N4O7S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid |
| SMILES | NC(C(=O)c1cc(OCCC2CCNCC2)no1)C(NS(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H26N4O7S/c21-17(18(20(26)27)24-32(28,29)14-4-2-1-3-5-14)19(25)15-12-16(23-31-15)30-11-8-13-6-9-22-10-7-13/h1-5,12-13,17-18,22,24H,6-11,21H2,(H,26,27) |
| InChIKey | RIVVLTJXRJOIFC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 173.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid?
The IUPAC name of 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid (CID 70092858) is 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid.
What is the SMILES notation for 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid?
The canonical SMILES for 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid is NC(C(=O)c1cc(OCCC2CCNCC2)no1)C(NS(=O)(=O)c1ccccc1)C(=O)O.
What is the InChIKey of 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid?
The InChIKey is RIVVLTJXRJOIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O7S/c21-17(18(20(26)27)24-32(28,29)14-4-2-1-3-5-14)19(25)15-12-16(23-31-15)30-11-8-13-6-9-22-10-7-13/h1-5,12-13,17-18,22,24H,6-11,21H2,(H,26,27).
What are the key properties of 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid?
3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid has a molecular weight of 466.52 g/mol, XLogP of 0.38, 11 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(benzenesulfonamido)-4-oxo-4-[3-(2-piperidin-4-ylethoxy)-1,2-oxazol-5-yl]butanoic acid is sourced from PubChem (CID 70092858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).