C14H26N2O — CID 70093035
1-tert-butyl-2,2-dimethyl-3a,4,5,6,9,9a-hexahydro-[1,3]oxazolo[5,4-c]azocine (PubChem CID 70093035) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-tert-butyl-2,2-dimethyl-3a,4,5,6,9,9a-hexahydro-[1,3]oxazolo[5,4-c]azocine.
| Compound Name | 1-tert-butyl-2,2-dimethyl-3a,4,5,6,9,9a-hexahydro-[1,3]oxazolo[5,4-c]azocine |
|---|---|
| PubChem CID | 70093035 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-tert-butyl-2,2-dimethyl-3a,4,5,6,9,9a-hexahydro-[1,3]oxazolo[5,4-c]azocine |
| SMILES | CC(C)(C)N1C2CC=CCNCC2OC1(C)C |
| InChI | InChI=1S/C14H26N2O/c1-13(2,3)16-11-8-6-7-9-15-10-12(11)17-14(16,4)5/h6-7,11-12,15H,8-10H2,1-5H3 |
| InChIKey | USGDMQSZZNHCDD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|