About 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one
6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one (PubChem CID 70093166) has the molecular formula C13H15BrN2O2
and a molecular weight of 311.18 g/mol. Its IUPAC name is 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one |
| PubChem CID | 70093166 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one |
| SMILES | O=C1OCc2cc(Br)ccc2N1C1CCNCC1 |
| InChI | InChI=1S/C13H15BrN2O2/c14-10-1-2-12-9(7-10)8-18-13(17)16(12)11-3-5-15-6-4-11/h1-2,7,11,15H,3-6,8H2 |
| InChIKey | FDLCYCKFIUSHFI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one?
The IUPAC name of 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one (CID 70093166) is 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one.
What is the SMILES notation for 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one?
The canonical SMILES for 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one is O=C1OCc2cc(Br)ccc2N1C1CCNCC1.
What is the InChIKey of 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one?
The InChIKey is FDLCYCKFIUSHFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O2/c14-10-1-2-12-9(7-10)8-18-13(17)16(12)11-3-5-15-6-4-11/h1-2,7,11,15H,3-6,8H2.
What are the key properties of 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one?
6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one has a molecular weight of 311.18 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-piperidin-4-yl-4H-3,1-benzoxazin-2-one is sourced from PubChem (CID 70093166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).