C35H35N5O4 — CID 70094227
benzyl N-[[4-[methyl-[(2R)-2-methyl-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1H-1,4-benzodiazepine-8-carbonyl]amino]phenyl]methylideneamino]carbamate (PubChem CID 70094227) has the molecular formula C35H35N5O4 and a molecular weight of 589.70 g/mol. Its IUPAC name is benzyl N-[[4-[methyl-[(2R)-2-methyl-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1H-1,4-benzodiazepine-8-carbonyl]amino]phenyl]methylideneamino]carbamate.
| Compound Name | benzyl N-[[4-[methyl-[(2R)-2-methyl-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1H-1,4-benzodiazepine-8-carbonyl]amino]phenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 70094227 |
| Molecular Formula | C35H35N5O4 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | benzyl N-[[4-[methyl-[(2R)-2-methyl-3-oxo-4-(2-phenylethyl)-2,5-dihydro-1H-1,4-benzodiazepine-8-carbonyl]amino]phenyl]methylideneamino]carbamate |
| SMILES | C[C@H]1Nc2cc(C(=O)N(C)c3ccc(C=NNC(=O)OCc4ccccc4)cc3)ccc2CN(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C35H35N5O4/c1-25-33(41)40(20-19-26-9-5-3-6-10-26)23-30-16-15-29(21-32(30)37-25)34(42)39(2)31-17-13-27(14-18-31)22-36-38-35(43)44-24-28-11-7-4-8-12-28/h3-18,21-22,25,37H,19-20,23-24H2,1-2H3,(H,38,43)/t25-/m1/s1 |
| InChIKey | ITHPJTRBGYLFFZ-RUZDIDTESA-N |
| XLogP | 5.61 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|