About (3,5-dibromophenyl)methanol
(3,5-dibromophenyl)methanol (PubChem CID 7009423) has the molecular formula C7H6Br2O
and a molecular weight of 265.93 g/mol. Its IUPAC name is (3,5-dibromophenyl)methanol.
Molecular Properties
| Compound Name | (3,5-dibromophenyl)methanol |
| PubChem CID | 7009423 |
| Molecular Formula | C7H6Br2O |
| Molecular Weight | 265.93 g/mol |
| Exact Mass | 263.88 |
| IUPAC Name | (3,5-dibromophenyl)methanol |
| SMILES | OCc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C7H6Br2O/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4H2 |
| InChIKey | ZQNSHKZQTZSNTB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.93 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,5-dibromophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dibromophenyl)methanol?
The IUPAC name of (3,5-dibromophenyl)methanol (CID 7009423) is (3,5-dibromophenyl)methanol.
What is the SMILES notation for (3,5-dibromophenyl)methanol?
The canonical SMILES for (3,5-dibromophenyl)methanol is OCc1cc(Br)cc(Br)c1.
What is the InChIKey of (3,5-dibromophenyl)methanol?
The InChIKey is ZQNSHKZQTZSNTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Br2O/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4H2.
What are the key properties of (3,5-dibromophenyl)methanol?
(3,5-dibromophenyl)methanol has a molecular weight of 265.93 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dibromophenyl)methanol is sourced from PubChem (CID 7009423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).