About thiophen-3-yl 4-fluorobenzoate
thiophen-3-yl 4-fluorobenzoate (PubChem CID 70094612) has the molecular formula C11H7FO2S
and a molecular weight of 222.24 g/mol. Its IUPAC name is thiophen-3-yl 4-fluorobenzoate.
Molecular Properties
| Compound Name | thiophen-3-yl 4-fluorobenzoate |
| PubChem CID | 70094612 |
| Molecular Formula | C11H7FO2S |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | thiophen-3-yl 4-fluorobenzoate |
| SMILES | O=C(Oc1ccsc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H7FO2S/c12-9-3-1-8(2-4-9)11(13)14-10-5-6-15-7-10/h1-7H |
| InChIKey | BIWDNKDRIHTMIS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiophen-3-yl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-yl 4-fluorobenzoate?
The IUPAC name of thiophen-3-yl 4-fluorobenzoate (CID 70094612) is thiophen-3-yl 4-fluorobenzoate.
What is the SMILES notation for thiophen-3-yl 4-fluorobenzoate?
The canonical SMILES for thiophen-3-yl 4-fluorobenzoate is O=C(Oc1ccsc1)c1ccc(F)cc1.
What is the InChIKey of thiophen-3-yl 4-fluorobenzoate?
The InChIKey is BIWDNKDRIHTMIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FO2S/c12-9-3-1-8(2-4-9)11(13)14-10-5-6-15-7-10/h1-7H.
What are the key properties of thiophen-3-yl 4-fluorobenzoate?
thiophen-3-yl 4-fluorobenzoate has a molecular weight of 222.24 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-yl 4-fluorobenzoate is sourced from PubChem (CID 70094612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).