About 4,4-difluoropiperidine;4-fluoropiperidine
4,4-difluoropiperidine;4-fluoropiperidine (PubChem CID 70094728) has the molecular formula C10H19F3N2
and a molecular weight of 224.27 g/mol. Its IUPAC name is 4,4-difluoropiperidine;4-fluoropiperidine.
Molecular Properties
| Compound Name | 4,4-difluoropiperidine;4-fluoropiperidine |
| PubChem CID | 70094728 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 4,4-difluoropiperidine;4-fluoropiperidine |
| SMILES | FC1(F)CCNCC1.FC1CCNCC1 |
| InChI | InChI=1S/C5H9F2N.C5H10FN/c6-5(7)1-3-8-4-2-5;6-5-1-3-7-4-2-5/h8H,1-4H2;5,7H,1-4H2 |
| InChIKey | IXLWFKOHMMFDET-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-difluoropiperidine;4-fluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoropiperidine;4-fluoropiperidine?
The IUPAC name of 4,4-difluoropiperidine;4-fluoropiperidine (CID 70094728) is 4,4-difluoropiperidine;4-fluoropiperidine.
What is the SMILES notation for 4,4-difluoropiperidine;4-fluoropiperidine?
The canonical SMILES for 4,4-difluoropiperidine;4-fluoropiperidine is FC1(F)CCNCC1.FC1CCNCC1.
What is the InChIKey of 4,4-difluoropiperidine;4-fluoropiperidine?
The InChIKey is IXLWFKOHMMFDET-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2N.C5H10FN/c6-5(7)1-3-8-4-2-5;6-5-1-3-7-4-2-5/h8H,1-4H2;5,7H,1-4H2.
What are the key properties of 4,4-difluoropiperidine;4-fluoropiperidine?
4,4-difluoropiperidine;4-fluoropiperidine has a molecular weight of 224.27 g/mol, XLogP of 1.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoropiperidine;4-fluoropiperidine is sourced from PubChem (CID 70094728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).