About 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one
5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one (PubChem CID 70094740) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one |
| PubChem CID | 70094740 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one |
| SMILES | C/C=C(/C)C1C(OC)C(=O)C=CC1(OC)OC |
| InChI | InChI=1S/C13H20O4/c1-6-9(2)11-12(15-3)10(14)7-8-13(11,16-4)17-5/h6-8,11-12H,1-5H3/b9-6- |
| InChIKey | FUSGCYGETBUIDQ-TWGQIWQCSA-N |
| XLogP | 1.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one?
The IUPAC name of 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one (CID 70094740) is 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one.
What is the SMILES notation for 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one?
The canonical SMILES for 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one is C/C=C(/C)C1C(OC)C(=O)C=CC1(OC)OC.
What is the InChIKey of 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one?
The InChIKey is FUSGCYGETBUIDQ-TWGQIWQCSA-N. The full InChI is InChI=1S/C13H20O4/c1-6-9(2)11-12(15-3)10(14)7-8-13(11,16-4)17-5/h6-8,11-12H,1-5H3/b9-6-.
What are the key properties of 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one?
5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one has a molecular weight of 240.30 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-but-2-en-2-yl]-4,4,6-trimethoxycyclohex-2-en-1-one is sourced from PubChem (CID 70094740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).