About 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one
7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one (PubChem CID 70094912) has the molecular formula C18H23N5O2
and a molecular weight of 341.42 g/mol. Its IUPAC name is 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one.
Molecular Properties
| Compound Name | 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one |
| PubChem CID | 70094912 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one |
| SMILES | CC[C@@H](CO)Nc1nc2nc(C)n(Cc3ccccc3)c2c(=O)n1C |
| InChI | InChI=1S/C18H23N5O2/c1-4-14(11-24)20-18-21-16-15(17(25)22(18)3)23(12(2)19-16)10-13-8-6-5-7-9-13/h5-9,14,24H,4,10-11H2,1-3H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | FNQDMLMIRYCTNP-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one?
The IUPAC name of 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one (CID 70094912) is 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one.
What is the SMILES notation for 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one?
The canonical SMILES for 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one is CC[C@@H](CO)Nc1nc2nc(C)n(Cc3ccccc3)c2c(=O)n1C.
What is the InChIKey of 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one?
The InChIKey is FNQDMLMIRYCTNP-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H23N5O2/c1-4-14(11-24)20-18-21-16-15(17(25)22(18)3)23(12(2)19-16)10-13-8-6-5-7-9-13/h5-9,14,24H,4,10-11H2,1-3H3,(H,20,21)/t14-/m0/s1.
What are the key properties of 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one?
7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one has a molecular weight of 341.42 g/mol, XLogP of 1.67, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-2-[[(2S)-1-hydroxybutan-2-yl]amino]-1,8-dimethylpurin-6-one is sourced from PubChem (CID 70094912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).