C20H33N3O4 — CID 70095007
but-2-enedioic acid;5-(dimethylhydrazinylidene)-N,N-diethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine (PubChem CID 70095007) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is but-2-enedioic acid;5-(dimethylhydrazinylidene)-N,N-diethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine.
| Compound Name | but-2-enedioic acid;5-(dimethylhydrazinylidene)-N,N-diethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 70095007 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | but-2-enedioic acid;5-(dimethylhydrazinylidene)-N,N-diethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
| SMILES | CCN(CC)C1CCC2=C(CCCC2=NN(C)C)C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H29N3.C4H4O4/c1-5-19(6-2)14-10-11-15-13(12-14)8-7-9-16(15)17-18(3)4;5-3(6)1-2-4(7)8/h14H,5-12H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | UZWZFAVGTQNPRH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|