About [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol
[3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol (PubChem CID 70095619) has the molecular formula C17H22FNO2
and a molecular weight of 291.37 g/mol. Its IUPAC name is [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol.
Molecular Properties
| Compound Name | [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
| PubChem CID | 70095619 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol |
| SMILES | OCC1C2CCC3(CN(CCc4ccc(F)cc4)CC13)O2 |
| InChI | InChI=1S/C17H22FNO2/c18-13-3-1-12(2-4-13)6-8-19-9-15-14(10-20)16-5-7-17(15,11-19)21-16/h1-4,14-16,20H,5-11H2 |
| InChIKey | ALRBZKQFQYSRJC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol?
The IUPAC name of [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol (CID 70095619) is [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol.
What is the SMILES notation for [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol?
The canonical SMILES for [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol is OCC1C2CCC3(CN(CCc4ccc(F)cc4)CC13)O2.
What is the InChIKey of [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol?
The InChIKey is ALRBZKQFQYSRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22FNO2/c18-13-3-1-12(2-4-13)6-8-19-9-15-14(10-20)16-5-7-17(15,11-19)21-16/h1-4,14-16,20H,5-11H2.
What are the key properties of [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol?
[3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol has a molecular weight of 291.37 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(4-fluorophenyl)ethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanol is sourced from PubChem (CID 70095619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).