About 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide
2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide (PubChem CID 70095661) has the molecular formula C22H24ClN3O2
and a molecular weight of 397.91 g/mol. Its IUPAC name is 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide |
| PubChem CID | 70095661 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide |
| SMILES | C[C@H](OCc1ccccc1)[C@H](CCc1ccccc1Cl)c1ncc(C(N)=O)[nH]1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-15(28-14-16-7-3-2-4-8-16)18(22-25-13-20(26-22)21(24)27)12-11-17-9-5-6-10-19(17)23/h2-10,13,15,18H,11-12,14H2,1H3,(H2,24,27)(H,25,26)/t15-,18-/m0/s1 |
| InChIKey | FPVQFFOQGUANNO-YJBOKZPZSA-N |
| XLogP | 4.48 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide?
The IUPAC name of 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide (CID 70095661) is 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide.
What is the SMILES notation for 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide?
The canonical SMILES for 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide is C[C@H](OCc1ccccc1)[C@H](CCc1ccccc1Cl)c1ncc(C(N)=O)[nH]1.
What is the InChIKey of 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide?
The InChIKey is FPVQFFOQGUANNO-YJBOKZPZSA-N. The full InChI is InChI=1S/C22H24ClN3O2/c1-15(28-14-16-7-3-2-4-8-16)18(22-25-13-20(26-22)21(24)27)12-11-17-9-5-6-10-19(17)23/h2-10,13,15,18H,11-12,14H2,1H3,(H2,24,27)(H,25,26)/t15-,18-/m0/s1.
What are the key properties of 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide?
2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide has a molecular weight of 397.91 g/mol, XLogP of 4.48, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-1-(2-chlorophenyl)-4-phenylmethoxypentan-3-yl]-1H-imidazole-5-carboxamide is sourced from PubChem (CID 70095661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).