About 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide
2-methylimidazo[1,2-a]pyridine-3-carbohydrazide (PubChem CID 700959) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide.
Molecular Properties
| Compound Name | 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide |
| PubChem CID | 700959 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide |
| SMILES | Cc1nc2ccccn2c1C(=O)NN |
| InChI | InChI=1S/C9H10N4O/c1-6-8(9(14)12-10)13-5-3-2-4-7(13)11-6/h2-5H,10H2,1H3,(H,12,14) |
| InChIKey | IOWSGEGUOPGCBC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide?
The IUPAC name of 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide (CID 700959) is 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide.
What is the SMILES notation for 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide?
The canonical SMILES for 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide is Cc1nc2ccccn2c1C(=O)NN.
What is the InChIKey of 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide?
The InChIKey is IOWSGEGUOPGCBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c1-6-8(9(14)12-10)13-5-3-2-4-7(13)11-6/h2-5H,10H2,1H3,(H,12,14).
What are the key properties of 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide?
2-methylimidazo[1,2-a]pyridine-3-carbohydrazide has a molecular weight of 190.21 g/mol, XLogP of 0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazo[1,2-a]pyridine-3-carbohydrazide is sourced from PubChem (CID 700959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).