About ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate
ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate (PubChem CID 70096425) has the molecular formula C23H20FNO5
and a molecular weight of 409.41 g/mol. Its IUPAC name is ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate |
| PubChem CID | 70096425 |
| Molecular Formula | C23H20FNO5 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C2COC(c3cccnc3Oc3ccc(F)cc3)O2)cc1 |
| InChI | InChI=1S/C23H20FNO5/c1-2-27-22(26)16-7-5-15(6-8-16)20-14-28-23(30-20)19-4-3-13-25-21(19)29-18-11-9-17(24)10-12-18/h3-13,20,23H,2,14H2,1H3 |
| InChIKey | GNMLDIJSTJLWQZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate?
The IUPAC name of ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate (CID 70096425) is ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate.
What is the SMILES notation for ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate?
The canonical SMILES for ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate is CCOC(=O)c1ccc(C2COC(c3cccnc3Oc3ccc(F)cc3)O2)cc1.
What is the InChIKey of ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate?
The InChIKey is GNMLDIJSTJLWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20FNO5/c1-2-27-22(26)16-7-5-15(6-8-16)20-14-28-23(30-20)19-4-3-13-25-21(19)29-18-11-9-17(24)10-12-18/h3-13,20,23H,2,14H2,1H3.
What are the key properties of ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate?
ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate has a molecular weight of 409.41 g/mol, XLogP of 4.98, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-[2-(4-fluorophenoxy)-3-pyridinyl]-1,3-dioxolan-4-yl]benzoate is sourced from PubChem (CID 70096425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).