C27H29FN2O5 — CID 70097482
5-(9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-16-yl)-1-(4-fluorophenyl)pentan-1-one;oxalic acid (PubChem CID 70097482) has the molecular formula C27H29FN2O5 and a molecular weight of 480.54 g/mol. Its IUPAC name is 5-(9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-16-yl)-1-(4-fluorophenyl)pentan-1-one;oxalic acid.
| Compound Name | 5-(9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-16-yl)-1-(4-fluorophenyl)pentan-1-one;oxalic acid |
|---|---|
| PubChem CID | 70097482 |
| Molecular Formula | C27H29FN2O5 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 5-(9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraen-16-yl)-1-(4-fluorophenyl)pentan-1-one;oxalic acid |
| SMILES | O=C(CCCCN1C2CCCC1c1c([nH]c3ccccc13)C2)c1ccc(F)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H27FN2O.C2H2O4/c26-18-13-11-17(12-14-18)24(29)10-3-4-15-28-19-6-5-9-23(28)25-20-7-1-2-8-21(20)27-22(25)16-19;3-1(4)2(5)6/h1-2,7-8,11-14,19,23,27H,3-6,9-10,15-16H2;(H,3,4)(H,5,6) |
| InChIKey | NQKYDPJVAZJXPJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|