About 3-amino-2,5-dihydro-1H-pyrazin-6-one
3-amino-2,5-dihydro-1H-pyrazin-6-one (PubChem CID 70097692) has the molecular formula C4H7N3O
and a molecular weight of 113.12 g/mol. Its IUPAC name is 3-amino-2,5-dihydro-1H-pyrazin-6-one.
Molecular Properties
| Compound Name | 3-amino-2,5-dihydro-1H-pyrazin-6-one |
| PubChem CID | 70097692 |
| Molecular Formula | C4H7N3O |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 3-amino-2,5-dihydro-1H-pyrazin-6-one |
| SMILES | NC1=NCC(=O)NC1 |
| InChI | InChI=1S/C4H7N3O/c5-3-1-7-4(8)2-6-3/h1-2H2,(H2,5,6)(H,7,8) |
| InChIKey | WJLPHZIMWIXZFA-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-2,5-dihydro-1H-pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,5-dihydro-1H-pyrazin-6-one?
The IUPAC name of 3-amino-2,5-dihydro-1H-pyrazin-6-one (CID 70097692) is 3-amino-2,5-dihydro-1H-pyrazin-6-one.
What is the SMILES notation for 3-amino-2,5-dihydro-1H-pyrazin-6-one?
The canonical SMILES for 3-amino-2,5-dihydro-1H-pyrazin-6-one is NC1=NCC(=O)NC1.
What is the InChIKey of 3-amino-2,5-dihydro-1H-pyrazin-6-one?
The InChIKey is WJLPHZIMWIXZFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O/c5-3-1-7-4(8)2-6-3/h1-2H2,(H2,5,6)(H,7,8).
What are the key properties of 3-amino-2,5-dihydro-1H-pyrazin-6-one?
3-amino-2,5-dihydro-1H-pyrazin-6-one has a molecular weight of 113.12 g/mol, XLogP of -1.53, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,5-dihydro-1H-pyrazin-6-one is sourced from PubChem (CID 70097692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).