C26H25F3N2O4 — CID 70097697
3-(3-methanehydrazonoylphenyl)-5-(4-phenylphenyl)pentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 70097697) has the molecular formula C26H25F3N2O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is 3-(3-methanehydrazonoylphenyl)-5-(4-phenylphenyl)pentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(3-methanehydrazonoylphenyl)-5-(4-phenylphenyl)pentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70097697 |
| Molecular Formula | C26H25F3N2O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-(3-methanehydrazonoylphenyl)-5-(4-phenylphenyl)pentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NN=Cc1cccc(C(CCc2ccc(-c3ccccc3)cc2)CC(=O)O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H24N2O2.C2HF3O2/c25-26-17-19-5-4-8-22(15-19)23(16-24(27)28)14-11-18-9-12-21(13-10-18)20-6-2-1-3-7-20;3-2(4,5)1(6)7/h1-10,12-13,15,17,23H,11,14,16,25H2,(H,27,28);(H,6,7) |
| InChIKey | PTWAZJNLXHVWRK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|