About ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate
ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate (PubChem CID 70097731) has the molecular formula C12H10ClN3O2S
and a molecular weight of 295.75 g/mol. Its IUPAC name is ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate |
| PubChem CID | 70097731 |
| Molecular Formula | C12H10ClN3O2S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate |
| SMILES | CCOC(=O)c1nnn2c1CSc1ccc(Cl)cc1-2 |
| InChI | InChI=1S/C12H10ClN3O2S/c1-2-18-12(17)11-9-6-19-10-4-3-7(13)5-8(10)16(9)15-14-11/h3-5H,2,6H2,1H3 |
| InChIKey | BSZKZCQTHWNKGZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate?
The IUPAC name of ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate (CID 70097731) is ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate.
What is the SMILES notation for ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate?
The canonical SMILES for ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate is CCOC(=O)c1nnn2c1CSc1ccc(Cl)cc1-2.
What is the InChIKey of ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate?
The InChIKey is BSZKZCQTHWNKGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3O2S/c1-2-18-12(17)11-9-6-19-10-4-3-7(13)5-8(10)16(9)15-14-11/h3-5H,2,6H2,1H3.
What are the key properties of ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate?
ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate has a molecular weight of 295.75 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 8-chloro-4H-triazolo[5,1-c][1,4]benzothiazine-3-carboxylate is sourced from PubChem (CID 70097731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).