3-(3,4-dihydropyrazol-2-yl)propanoic acid

C6H10N2O2 — CID 70097923

IUPAC3-(3,4-dihydropyrazol-2-yl)propanoic acid
SMILESO=C(O)CCN1CCC=N1
InChIInChI=1S/C6H10N2O2/c9-6(10)2-5-8-4-1-3-7-8/h3H,1-2,4-5H2,(H,9,10)
InChIKeyUXSIQXDBSPDDOO-UHFFFAOYSA-N
MW142.16 g/mol
LogP0.15
Rot. Bonds3

About 3-(3,4-dihydropyrazol-2-yl)propanoic acid

3-(3,4-dihydropyrazol-2-yl)propanoic acid (PubChem CID 70097923) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 3-(3,4-dihydropyrazol-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(3,4-dihydropyrazol-2-yl)propanoic acid
PubChem CID70097923
Molecular FormulaC6H10N2O2
Molecular Weight142.16 g/mol
Exact Mass142.07
IUPAC Name3-(3,4-dihydropyrazol-2-yl)propanoic acid
SMILESO=C(O)CCN1CCC=N1
InChIInChI=1S/C6H10N2O2/c9-6(10)2-5-8-4-1-3-7-8/h3H,1-2,4-5H2,(H,9,10)
InChIKeyUXSIQXDBSPDDOO-UHFFFAOYSA-N
XLogP0.15
TPSA52.90 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.16
LogP ≤ 50.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3,4-dihydropyrazol-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-dihydropyrazol-2-yl)propanoic acid?
The IUPAC name of 3-(3,4-dihydropyrazol-2-yl)propanoic acid (CID 70097923) is 3-(3,4-dihydropyrazol-2-yl)propanoic acid.
What is the SMILES notation for 3-(3,4-dihydropyrazol-2-yl)propanoic acid?
The canonical SMILES for 3-(3,4-dihydropyrazol-2-yl)propanoic acid is O=C(O)CCN1CCC=N1.
What is the InChIKey of 3-(3,4-dihydropyrazol-2-yl)propanoic acid?
The InChIKey is UXSIQXDBSPDDOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c9-6(10)2-5-8-4-1-3-7-8/h3H,1-2,4-5H2,(H,9,10).
What are the key properties of 3-(3,4-dihydropyrazol-2-yl)propanoic acid?
3-(3,4-dihydropyrazol-2-yl)propanoic acid has a molecular weight of 142.16 g/mol, XLogP of 0.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydropyrazol-2-yl)propanoic acid is sourced from PubChem (CID 70097923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).