About 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride
3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride (PubChem CID 70098095) has the molecular formula C21H26Cl2N2O2
and a molecular weight of 409.36 g/mol. Its IUPAC name is 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride |
| PubChem CID | 70098095 |
| Molecular Formula | C21H26Cl2N2O2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride |
| SMILES | CN1[C@@H]2CC[C@H]1CC(N(c1ccccc1)c1cccc(C(=O)O)c1)C2.Cl.Cl |
| InChI | InChI=1S/C21H24N2O2.2ClH/c1-22-17-10-11-18(22)14-20(13-17)23(16-7-3-2-4-8-16)19-9-5-6-15(12-19)21(24)25;;/h2-9,12,17-18,20H,10-11,13-14H2,1H3,(H,24,25);2*1H/t17-,18+,20?;; |
| InChIKey | YFROOGZZBLFPRW-MZAVLPEASA-N |
| XLogP | 4.99 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride?
The IUPAC name of 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride (CID 70098095) is 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride.
What is the SMILES notation for 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride?
The canonical SMILES for 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride is CN1[C@@H]2CC[C@H]1CC(N(c1ccccc1)c1cccc(C(=O)O)c1)C2.Cl.Cl.
What is the InChIKey of 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride?
The InChIKey is YFROOGZZBLFPRW-MZAVLPEASA-N. The full InChI is InChI=1S/C21H24N2O2.2ClH/c1-22-17-10-11-18(22)14-20(13-17)23(16-7-3-2-4-8-16)19-9-5-6-15(12-19)21(24)25;;/h2-9,12,17-18,20H,10-11,13-14H2,1H3,(H,24,25);2*1H/t17-,18+,20?;;.
What are the key properties of 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride?
3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride has a molecular weight of 409.36 g/mol, XLogP of 4.99, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzoic acid;dihydrochloride is sourced from PubChem (CID 70098095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).